C14H22N2O4 — CID 81219393
N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propanamide (PubChem CID 81219393) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propanamide |
|---|---|
| PubChem CID | 81219393 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propanamide |
| SMILES | CC1COC(CO)CN1C(C)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H22N2O4/c1-10-9-20-13(8-17)7-16(10)11(2)14(18)15-6-12-4-3-5-19-12/h3-5,10-11,13,17H,6-9H2,1-2H3,(H,15,18) |
| InChIKey | LQCLAZPXBPTUJH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |