C15H10Cl2N2O — CID 81220374
(3,5-dichloro-2-pyridinyl)-quinolin-5-ylmethanol (PubChem CID 81220374) has the molecular formula C15H10Cl2N2O and a molecular weight of 305.16 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl)-quinolin-5-ylmethanol.
| Compound Name | (3,5-dichloro-2-pyridinyl)-quinolin-5-ylmethanol |
|---|---|
| PubChem CID | 81220374 |
| Molecular Formula | C15H10Cl2N2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl)-quinolin-5-ylmethanol |
| SMILES | OC(c1ncc(Cl)cc1Cl)c1cccc2ncccc12 |
| InChI | InChI=1S/C15H10Cl2N2O/c16-9-7-12(17)14(19-8-9)15(20)11-3-1-5-13-10(11)4-2-6-18-13/h1-8,15,20H |
| InChIKey | LKUQLVFEXLOMSS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |