C16H11Br2NO — CID 107978579
(3,5-dibromophenyl)-quinolin-5-ylmethanol (PubChem CID 107978579) has the molecular formula C16H11Br2NO and a molecular weight of 393.08 g/mol. Its IUPAC name is (3,5-dibromophenyl)-quinolin-5-ylmethanol.
| Compound Name | (3,5-dibromophenyl)-quinolin-5-ylmethanol |
|---|---|
| PubChem CID | 107978579 |
| Molecular Formula | C16H11Br2NO |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | (3,5-dibromophenyl)-quinolin-5-ylmethanol |
| SMILES | OC(c1cc(Br)cc(Br)c1)c1cccc2ncccc12 |
| InChI | InChI=1S/C16H11Br2NO/c17-11-7-10(8-12(18)9-11)16(20)14-3-1-5-15-13(14)4-2-6-19-15/h1-9,16,20H |
| InChIKey | XULIDMZVSZGOES-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |