C14H12ClN5 — CID 81221970
4-chloro-N,N-dimethyl-6-quinolin-5-yl-1,3,5-triazin-2-amine (PubChem CID 81221970) has the molecular formula C14H12ClN5 and a molecular weight of 285.74 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-6-quinolin-5-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-dimethyl-6-quinolin-5-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 81221970 |
| Molecular Formula | C14H12ClN5 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-chloro-N,N-dimethyl-6-quinolin-5-yl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(Cl)nc(-c2cccc3ncccc23)n1 |
| InChI | InChI=1S/C14H12ClN5/c1-20(2)14-18-12(17-13(15)19-14)10-5-3-7-11-9(10)6-4-8-16-11/h3-8H,1-2H3 |
| InChIKey | NZEWFDMCJGFCHA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |