C19H21FN4O — CID 812253
1-(4-fluorophenyl)-N-(2-methylpropyl)-3-(1-methylpyrrol-2-yl)pyrazole-5-carboxamide (PubChem CID 812253) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(2-methylpropyl)-3-(1-methylpyrrol-2-yl)pyrazole-5-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(2-methylpropyl)-3-(1-methylpyrrol-2-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 812253 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(2-methylpropyl)-3-(1-methylpyrrol-2-yl)pyrazole-5-carboxamide |
| SMILES | CC(C)CNC(=O)c1cc(-c2cccn2C)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN4O/c1-13(2)12-21-19(25)18-11-16(17-5-4-10-23(17)3)22-24(18)15-8-6-14(20)7-9-15/h4-11,13H,12H2,1-3H3,(H,21,25) |
| InChIKey | GQUHBEGHVBINGV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |