C17H24N2 — CID 81231235
N,4-dimethyl-1-(2-methylquinolin-6-yl)pentan-1-amine (PubChem CID 81231235) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N,4-dimethyl-1-(2-methylquinolin-6-yl)pentan-1-amine.
| Compound Name | N,4-dimethyl-1-(2-methylquinolin-6-yl)pentan-1-amine |
|---|---|
| PubChem CID | 81231235 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N,4-dimethyl-1-(2-methylquinolin-6-yl)pentan-1-amine |
| SMILES | CNC(CCC(C)C)c1ccc2nc(C)ccc2c1 |
| InChI | InChI=1S/C17H24N2/c1-12(2)5-9-16(18-4)14-8-10-17-15(11-14)7-6-13(3)19-17/h6-8,10-12,16,18H,5,9H2,1-4H3 |
| InChIKey | ZGKPQAMYTRVKAJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |