C14H14ClNO3 — CID 81235555
3-(chloromethyl)-4-(2,6-dimethoxyphenoxy)pyridine (PubChem CID 81235555) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(2,6-dimethoxyphenoxy)pyridine.
| Compound Name | 3-(chloromethyl)-4-(2,6-dimethoxyphenoxy)pyridine |
|---|---|
| PubChem CID | 81235555 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(chloromethyl)-4-(2,6-dimethoxyphenoxy)pyridine |
| SMILES | COc1cccc(OC)c1Oc1ccncc1CCl |
| InChI | InChI=1S/C14H14ClNO3/c1-17-12-4-3-5-13(18-2)14(12)19-11-6-7-16-9-10(11)8-15/h3-7,9H,8H2,1-2H3 |
| InChIKey | GQDLBUBPGYXLSY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|