C15H14N4OS — CID 81238546
N-(1,3-benzothiazol-2-yl)-4-(ethylamino)pyridine-3-carboxamide (PubChem CID 81238546) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(ethylamino)pyridine-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(ethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81238546 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(ethylamino)pyridine-3-carboxamide |
| SMILES | CCNc1ccncc1C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H14N4OS/c1-2-17-11-7-8-16-9-10(11)14(20)19-15-18-12-5-3-4-6-13(12)21-15/h3-9H,2H2,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | XYBRGIVMYVCVEB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |