C17H25N3O — CID 81249049
N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]-5-(propylaminomethyl)pyridin-4-amine (PubChem CID 81249049) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]-5-(propylaminomethyl)pyridin-4-amine.
| Compound Name | N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]-5-(propylaminomethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 81249049 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]-5-(propylaminomethyl)pyridin-4-amine |
| SMILES | CCCNCc1cnc(C)cc1N(C)Cc1ccc(C)o1 |
| InChI | InChI=1S/C17H25N3O/c1-5-8-18-10-15-11-19-13(2)9-17(15)20(4)12-16-7-6-14(3)21-16/h6-7,9,11,18H,5,8,10,12H2,1-4H3 |
| InChIKey | YSNIJKFGAUNHFV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|