C18H31N3 — CID 81253096
N,2-dimethyl-N-(4-methylcyclohexyl)-5-(propylaminomethyl)pyridin-4-amine (PubChem CID 81253096) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is N,2-dimethyl-N-(4-methylcyclohexyl)-5-(propylaminomethyl)pyridin-4-amine.
| Compound Name | N,2-dimethyl-N-(4-methylcyclohexyl)-5-(propylaminomethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 81253096 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | N,2-dimethyl-N-(4-methylcyclohexyl)-5-(propylaminomethyl)pyridin-4-amine |
| SMILES | CCCNCc1cnc(C)cc1N(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C18H31N3/c1-5-10-19-12-16-13-20-15(3)11-18(16)21(4)17-8-6-14(2)7-9-17/h11,13-14,17,19H,5-10,12H2,1-4H3 |
| InChIKey | URXGDUDWGVDYMS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|