C15H23ClN2 — CID 81234834
5-(chloromethyl)-N,2-dimethyl-N-(4-methylcyclohexyl)pyridin-4-amine (PubChem CID 81234834) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 5-(chloromethyl)-N,2-dimethyl-N-(4-methylcyclohexyl)pyridin-4-amine.
| Compound Name | 5-(chloromethyl)-N,2-dimethyl-N-(4-methylcyclohexyl)pyridin-4-amine |
|---|---|
| PubChem CID | 81234834 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-(chloromethyl)-N,2-dimethyl-N-(4-methylcyclohexyl)pyridin-4-amine |
| SMILES | Cc1cc(N(C)C2CCC(C)CC2)c(CCl)cn1 |
| InChI | InChI=1S/C15H23ClN2/c1-11-4-6-14(7-5-11)18(3)15-8-12(2)17-10-13(15)9-16/h8,10-11,14H,4-7,9H2,1-3H3 |
| InChIKey | GFDMMAXOGGPBMQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|