C14H14BrClN2O — CID 81250588
N-[[4-(2-bromo-4-chlorophenoxy)-3-pyridinyl]methyl]ethanamine (PubChem CID 81250588) has the molecular formula C14H14BrClN2O and a molecular weight of 341.64 g/mol. Its IUPAC name is N-[[4-(2-bromo-4-chlorophenoxy)-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[4-(2-bromo-4-chlorophenoxy)-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 81250588 |
| Molecular Formula | C14H14BrClN2O |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-[[4-(2-bromo-4-chlorophenoxy)-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cnccc1Oc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C14H14BrClN2O/c1-2-17-8-10-9-18-6-5-13(10)19-14-4-3-11(16)7-12(14)15/h3-7,9,17H,2,8H2,1H3 |
| InChIKey | GEUVFRNYORDZRG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |