C13H16BrNOS2 — CID 81261701
(3-bromopiperidin-1-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone (PubChem CID 81261701) has the molecular formula C13H16BrNOS2 and a molecular weight of 346.32 g/mol. Its IUPAC name is (3-bromopiperidin-1-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone.
| Compound Name | (3-bromopiperidin-1-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone |
|---|---|
| PubChem CID | 81261701 |
| Molecular Formula | C13H16BrNOS2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | (3-bromopiperidin-1-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone |
| SMILES | O=C(c1cc2c(s1)CCSC2)N1CCCC(Br)C1 |
| InChI | InChI=1S/C13H16BrNOS2/c14-10-2-1-4-15(7-10)13(16)12-6-9-8-17-5-3-11(9)18-12/h6,10H,1-5,7-8H2 |
| InChIKey | VYPCZJPAFHSEPJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|