C14H18BrNOS2 — CID 81261792
[3-(bromomethyl)piperidin-1-yl]-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone (PubChem CID 81261792) has the molecular formula C14H18BrNOS2 and a molecular weight of 360.34 g/mol. Its IUPAC name is [3-(bromomethyl)piperidin-1-yl]-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone.
| Compound Name | [3-(bromomethyl)piperidin-1-yl]-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone |
|---|---|
| PubChem CID | 81261792 |
| Molecular Formula | C14H18BrNOS2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | [3-(bromomethyl)piperidin-1-yl]-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone |
| SMILES | O=C(c1cc2c(s1)CCSC2)N1CCCC(CBr)C1 |
| InChI | InChI=1S/C14H18BrNOS2/c15-7-10-2-1-4-16(8-10)14(17)13-6-11-9-18-5-3-12(11)19-13/h6,10H,1-5,7-9H2 |
| InChIKey | GRHVWERDKJESQQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|