C12H13ClFN3O2 — CID 81262533
N-[(2E)-2-amino-1-cyclopropyl-2-hydroxyiminoethyl]-3-chloro-2-fluorobenzamide (PubChem CID 81262533) has the molecular formula C12H13ClFN3O2 and a molecular weight of 285.71 g/mol. Its IUPAC name is N-[(2E)-2-amino-1-cyclopropyl-2-hydroxyiminoethyl]-3-chloro-2-fluorobenzamide.
| Compound Name | N-[(2E)-2-amino-1-cyclopropyl-2-hydroxyiminoethyl]-3-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 81262533 |
| Molecular Formula | C12H13ClFN3O2 |
| Molecular Weight | 285.71 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[(2E)-2-amino-1-cyclopropyl-2-hydroxyiminoethyl]-3-chloro-2-fluorobenzamide |
| SMILES | N/C(=N/O)C(NC(=O)c1cccc(Cl)c1F)C1CC1 |
| InChI | InChI=1S/C12H13ClFN3O2/c13-8-3-1-2-7(9(8)14)12(18)16-10(6-4-5-6)11(15)17-19/h1-3,6,10,19H,4-5H2,(H2,15,17)(H,16,18) |
| InChIKey | SNHFXPBTCAPVPE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|