C13H13N3O2S3 — CID 81266553
N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 81266553) has the molecular formula C13H13N3O2S3 and a molecular weight of 339.47 g/mol. Its IUPAC name is N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 81266553 |
| Molecular Formula | C13H13N3O2S3 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | CC(=NO)c1csc(NC(=O)c2cc3c(s2)CCSC3)n1 |
| InChI | InChI=1S/C13H13N3O2S3/c1-7(16-18)9-6-20-13(14-9)15-12(17)11-4-8-5-19-3-2-10(8)21-11/h4,6,18H,2-3,5H2,1H3,(H,14,15,17) |
| InChIKey | PZWUAJWJCOEAJV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|