C16H20ClNO2S — CID 81267904
2-tert-butylsulfanyl-N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]acetamide (PubChem CID 81267904) has the molecular formula C16H20ClNO2S and a molecular weight of 325.86 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]acetamide.
| Compound Name | 2-tert-butylsulfanyl-N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 81267904 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-tert-butylsulfanyl-N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]acetamide |
| SMILES | CC(C)(C)SCC(=O)Nc1cc(Cl)ccc1C#CCCO |
| InChI | InChI=1S/C16H20ClNO2S/c1-16(2,3)21-11-15(20)18-14-10-13(17)8-7-12(14)6-4-5-9-19/h7-8,10,19H,5,9,11H2,1-3H3,(H,18,20) |
| InChIKey | RVQNVERTDNSGEC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|