C13H11ClN4O2 — CID 81270807
N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 81270807) has the molecular formula C13H11ClN4O2 and a molecular weight of 290.71 g/mol. Its IUPAC name is N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 81270807 |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-[5-chloro-2-(4-hydroxybut-1-ynyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1C#CCCO)c1cn[nH]n1 |
| InChI | InChI=1S/C13H11ClN4O2/c14-10-5-4-9(3-1-2-6-19)11(7-10)16-13(20)12-8-15-18-17-12/h4-5,7-8,19H,2,6H2,(H,16,20)(H,15,17,18) |
| InChIKey | XVPBRGHEOVMLFN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|