C17H19BrClN — CID 81271218
2-bromo-5-chloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline (PubChem CID 81271218) has the molecular formula C17H19BrClN and a molecular weight of 352.70 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline.
| Compound Name | 2-bromo-5-chloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 81271218 |
| Molecular Formula | C17H19BrClN |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-bromo-5-chloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline |
| SMILES | Cc1cc(C)c(C(C)Nc2cc(Cl)ccc2Br)c(C)c1 |
| InChI | InChI=1S/C17H19BrClN/c1-10-7-11(2)17(12(3)8-10)13(4)20-16-9-14(19)5-6-15(16)18/h5-9,13,20H,1-4H3 |
| InChIKey | SNPHIFRFMRRLCJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |