C15H19N3 — CID 81274169
4-[2-cyanoethyl(2-methylpropyl)amino]-2-methylbenzonitrile (PubChem CID 81274169) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-[2-cyanoethyl(2-methylpropyl)amino]-2-methylbenzonitrile.
| Compound Name | 4-[2-cyanoethyl(2-methylpropyl)amino]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 81274169 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-[2-cyanoethyl(2-methylpropyl)amino]-2-methylbenzonitrile |
| SMILES | Cc1cc(N(CCC#N)CC(C)C)ccc1C#N |
| InChI | InChI=1S/C15H19N3/c1-12(2)11-18(8-4-7-16)15-6-5-14(10-17)13(3)9-15/h5-6,9,12H,4,8,11H2,1-3H3 |
| InChIKey | MVAZXYKICYHYQJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |