C13H16N4O — CID 81277289
4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2-methylbenzenecarboximidamide (PubChem CID 81277289) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2-methylbenzenecarboximidamide.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 81277289 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2-methylbenzenecarboximidamide |
| SMILES | Cc1cc(C)n(-c2ccc(/C(N)=N/O)c(C)c2)n1 |
| InChI | InChI=1S/C13H16N4O/c1-8-6-11(4-5-12(8)13(14)16-18)17-10(3)7-9(2)15-17/h4-7,18H,1-3H3,(H2,14,16) |
| InChIKey | QPXDOIBFKKFMCG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|