C15H16N2O2 — CID 81278044
N'-hydroxy-2-methyl-4-phenylmethoxybenzenecarboximidamide (PubChem CID 81278044) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-4-phenylmethoxybenzenecarboximidamide.
| Compound Name | N'-hydroxy-2-methyl-4-phenylmethoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 81278044 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N'-hydroxy-2-methyl-4-phenylmethoxybenzenecarboximidamide |
| SMILES | Cc1cc(OCc2ccccc2)ccc1/C(N)=N/O |
| InChI | InChI=1S/C15H16N2O2/c1-11-9-13(7-8-14(11)15(16)17-18)19-10-12-5-3-2-4-6-12/h2-9,18H,10H2,1H3,(H2,16,17) |
| InChIKey | ARTRJPNNASSUOX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|