C11H10BrClN4O2S — CID 81279969
N-(2-bromo-5-chlorophenyl)-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 81279969) has the molecular formula C11H10BrClN4O2S and a molecular weight of 377.65 g/mol. Its IUPAC name is N-(2-bromo-5-chlorophenyl)-2-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(2-bromo-5-chlorophenyl)-2-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 81279969 |
| Molecular Formula | C11H10BrClN4O2S |
| Molecular Weight | 377.65 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | N-(2-bromo-5-chlorophenyl)-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ncccc1S(=O)(=O)Nc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C11H10BrClN4O2S/c12-8-4-3-7(13)6-9(8)17-20(18,19)10-2-1-5-15-11(10)16-14/h1-6,17H,14H2,(H,15,16) |
| InChIKey | BJKBYJGNPXAWDN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|