C11H10ClFN4O2S — CID 61468313
N-(4-chloro-3-fluorophenyl)-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 61468313) has the molecular formula C11H10ClFN4O2S and a molecular weight of 316.75 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-2-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-2-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61468313 |
| Molecular Formula | C11H10ClFN4O2S |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ncccc1S(=O)(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H10ClFN4O2S/c12-8-4-3-7(6-9(8)13)17-20(18,19)10-2-1-5-15-11(10)16-14/h1-6,17H,14H2,(H,15,16) |
| InChIKey | NPQNKSWRPOTQNB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|