C12H12N4O4S — CID 43456605
N-(1,3-benzodioxol-5-yl)-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 43456605) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 43456605 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ncccc1S(=O)(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12N4O4S/c13-15-12-11(2-1-5-14-12)21(17,18)16-8-3-4-9-10(6-8)20-7-19-9/h1-6,16H,7,13H2,(H,14,15) |
| InChIKey | ZJOWAQISNSWDAP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|