C12H11N3O4S — CID 62163676
2-amino-N-(1,3-benzodioxol-5-yl)pyridine-3-sulfonamide (PubChem CID 62163676) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzodioxol-5-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-(1,3-benzodioxol-5-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62163676 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-amino-N-(1,3-benzodioxol-5-yl)pyridine-3-sulfonamide |
| SMILES | Nc1ncccc1S(=O)(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11N3O4S/c13-12-11(2-1-5-14-12)20(16,17)15-8-3-4-9-10(6-8)19-7-18-9/h1-6,15H,7H2,(H2,13,14) |
| InChIKey | OOLDMUGLJLPNTE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |