C14H14ClN5O — CID 81281009
N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-3-(triazol-1-yl)propanamide (PubChem CID 81281009) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-3-(triazol-1-yl)propanamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-3-(triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 81281009 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-5-chlorophenyl]-3-(triazol-1-yl)propanamide |
| SMILES | NCC#Cc1ccc(Cl)cc1NC(=O)CCn1ccnn1 |
| InChI | InChI=1S/C14H14ClN5O/c15-12-4-3-11(2-1-6-16)13(10-12)18-14(21)5-8-20-9-7-17-19-20/h3-4,7,9-10H,5-6,8,16H2,(H,18,21) |
| InChIKey | OAKUVDWRNJYIEQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|