About 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole
1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole (PubChem CID 81281428) has the molecular formula C14H7BrCl2F2N2
and a molecular weight of 392.03 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole.
Molecular Properties
| Compound Name | 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole |
| PubChem CID | 81281428 |
| Molecular Formula | C14H7BrCl2F2N2 |
| Molecular Weight | 392.03 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole |
| SMILES | Fc1ccc2nc(CCl)n(-c3ccc(Cl)cc3Br)c2c1F |
| InChI | InChI=1S/C14H7BrCl2F2N2/c15-8-5-7(17)1-4-11(8)21-12(6-16)20-10-3-2-9(18)13(19)14(10)21/h1-5H,6H2 |
| InChIKey | PJGRVGGVKHQPHY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole?
The IUPAC name of 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole (CID 81281428) is 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole.
What is the SMILES notation for 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole?
The canonical SMILES for 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole is Fc1ccc2nc(CCl)n(-c3ccc(Cl)cc3Br)c2c1F.
What is the InChIKey of 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole?
The InChIKey is PJGRVGGVKHQPHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7BrCl2F2N2/c15-8-5-7(17)1-4-11(8)21-12(6-16)20-10-3-2-9(18)13(19)14(10)21/h1-5H,6H2.
What are the key properties of 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole?
1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole has a molecular weight of 392.03 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-4-chlorophenyl)-2-(chloromethyl)-6,7-difluorobenzimidazole is sourced from PubChem (CID 81281428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).