C16H13ClF2N2 — CID 63547054
2-(chloromethyl)-1-(2-ethylphenyl)-6,7-difluorobenzimidazole (PubChem CID 63547054) has the molecular formula C16H13ClF2N2 and a molecular weight of 306.74 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2-ethylphenyl)-6,7-difluorobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(2-ethylphenyl)-6,7-difluorobenzimidazole |
|---|---|
| PubChem CID | 63547054 |
| Molecular Formula | C16H13ClF2N2 |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(chloromethyl)-1-(2-ethylphenyl)-6,7-difluorobenzimidazole |
| SMILES | CCc1ccccc1-n1c(CCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C16H13ClF2N2/c1-2-10-5-3-4-6-13(10)21-14(9-17)20-12-8-7-11(18)15(19)16(12)21/h3-8H,2,9H2,1H3 |
| InChIKey | NMFVVZGOBIFQTB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|