About 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile
4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile (PubChem CID 81283123) has the molecular formula C14H13F2N3
and a molecular weight of 261.27 g/mol. Its IUPAC name is 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile |
| PubChem CID | 81283123 |
| Molecular Formula | C14H13F2N3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile |
| SMILES | CCc1c(C)nn(-c2c(F)cc(C#N)cc2F)c1C |
| InChI | InChI=1S/C14H13F2N3/c1-4-11-8(2)18-19(9(11)3)14-12(15)5-10(7-17)6-13(14)16/h5-6H,4H2,1-3H3 |
| InChIKey | UVJURAJYGJQBDS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile?
The IUPAC name of 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile (CID 81283123) is 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile?
The canonical SMILES for 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile is CCc1c(C)nn(-c2c(F)cc(C#N)cc2F)c1C.
What is the InChIKey of 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile?
The InChIKey is UVJURAJYGJQBDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2N3/c1-4-11-8(2)18-19(9(11)3)14-12(15)5-10(7-17)6-13(14)16/h5-6H,4H2,1-3H3.
What are the key properties of 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile?
4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile has a molecular weight of 261.27 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3,5-difluorobenzonitrile is sourced from PubChem (CID 81283123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).