C13H14FN3O2 — CID 80749088
4-ethyl-1-(3-fluoro-5-nitrophenyl)-3,5-dimethylpyrazole (PubChem CID 80749088) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is 4-ethyl-1-(3-fluoro-5-nitrophenyl)-3,5-dimethylpyrazole.
| Compound Name | 4-ethyl-1-(3-fluoro-5-nitrophenyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 80749088 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-ethyl-1-(3-fluoro-5-nitrophenyl)-3,5-dimethylpyrazole |
| SMILES | CCc1c(C)nn(-c2cc(F)cc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C13H14FN3O2/c1-4-13-8(2)15-16(9(13)3)11-5-10(14)6-12(7-11)17(18)19/h5-7H,4H2,1-3H3 |
| InChIKey | DTPLQNSJBPNLGY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|