C14H9ClF2N2O — CID 81283320
4-(5-chloro-2-methoxyanilino)-3,5-difluorobenzonitrile (PubChem CID 81283320) has the molecular formula C14H9ClF2N2O and a molecular weight of 294.69 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxyanilino)-3,5-difluorobenzonitrile.
| Compound Name | 4-(5-chloro-2-methoxyanilino)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81283320 |
| Molecular Formula | C14H9ClF2N2O |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-(5-chloro-2-methoxyanilino)-3,5-difluorobenzonitrile |
| SMILES | COc1ccc(Cl)cc1Nc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C14H9ClF2N2O/c1-20-13-3-2-9(15)6-12(13)19-14-10(16)4-8(7-18)5-11(14)17/h2-6,19H,1H3 |
| InChIKey | LXWBJSLNTVOFLK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |