C14H10F2N2 — CID 81283901
3,5-difluoro-4-(2-methylanilino)benzonitrile (PubChem CID 81283901) has the molecular formula C14H10F2N2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-methylanilino)benzonitrile.
| Compound Name | 3,5-difluoro-4-(2-methylanilino)benzonitrile |
|---|---|
| PubChem CID | 81283901 |
| Molecular Formula | C14H10F2N2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3,5-difluoro-4-(2-methylanilino)benzonitrile |
| SMILES | Cc1ccccc1Nc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C14H10F2N2/c1-9-4-2-3-5-13(9)18-14-11(15)6-10(8-17)7-12(14)16/h2-7,18H,1H3 |
| InChIKey | OLKBYOLGJGHKKJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |