C14H20FN3O3 — CID 81289261
4-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]pentan-3-yl]-3-methoxybenzamide (PubChem CID 81289261) has the molecular formula C14H20FN3O3 and a molecular weight of 297.33 g/mol. Its IUPAC name is 4-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]pentan-3-yl]-3-methoxybenzamide.
| Compound Name | 4-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]pentan-3-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 81289261 |
| Molecular Formula | C14H20FN3O3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]pentan-3-yl]-3-methoxybenzamide |
| SMILES | CCC(CC)(NC(=O)c1ccc(F)c(OC)c1)/C(N)=N/O |
| InChI | InChI=1S/C14H20FN3O3/c1-4-14(5-2,13(16)18-20)17-12(19)9-6-7-10(15)11(8-9)21-3/h6-8,20H,4-5H2,1-3H3,(H2,16,18)(H,17,19) |
| InChIKey | QVWGXXZBSFAROP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|