C12H15FN2O2S — CID 81284104
N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-4-fluoro-3-methoxybenzamide (PubChem CID 81284104) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-4-fluoro-3-methoxybenzamide.
| Compound Name | N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-4-fluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 81284104 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-4-fluoro-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)(C)C(N)=S)ccc1F |
| InChI | InChI=1S/C12H15FN2O2S/c1-12(2,11(14)18)15-10(16)7-4-5-8(13)9(6-7)17-3/h4-6H,1-3H3,(H2,14,18)(H,15,16) |
| InChIKey | DFUUQAQVAYMSON-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|