C10H8F6N2O — CID 81293376
3,5-difluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide (PubChem CID 81293376) has the molecular formula C10H8F6N2O and a molecular weight of 286.18 g/mol. Its IUPAC name is 3,5-difluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide.
| Compound Name | 3,5-difluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 81293376 |
| Molecular Formula | C10H8F6N2O |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 3,5-difluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(OCC(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C10H8F6N2O/c11-5-1-4(8(17)18)2-6(12)7(5)19-3-10(15,16)9(13)14/h1-2,9H,3H2,(H3,17,18) |
| InChIKey | UZKLKRPOQGODDX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|