C14H11ClN2O4 — CID 81294234
(E)-3-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 81294234) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is (E)-3-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81294234 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (E)-3-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(NC(=O)c2ccc(/C=C/C(=O)O)c(Cl)c2)no1 |
| InChI | InChI=1S/C14H11ClN2O4/c1-8-6-12(17-21-8)16-14(20)10-3-2-9(11(15)7-10)4-5-13(18)19/h2-7H,1H3,(H,18,19)(H,16,17,20)/b5-4+ |
| InChIKey | LILWFZHJHGACNC-SNAWJCMRSA-N |
| XLogP | 2.99 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|