C15H23F2N3 — CID 81294671
3,5-difluoro-4-[pentyl(propan-2-yl)amino]benzenecarboximidamide (PubChem CID 81294671) has the molecular formula C15H23F2N3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3,5-difluoro-4-[pentyl(propan-2-yl)amino]benzenecarboximidamide.
| Compound Name | 3,5-difluoro-4-[pentyl(propan-2-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 81294671 |
| Molecular Formula | C15H23F2N3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 3,5-difluoro-4-[pentyl(propan-2-yl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(N(CCCCC)C(C)C)c(F)c1 |
| InChI | InChI=1S/C15H23F2N3/c1-4-5-6-7-20(10(2)3)14-12(16)8-11(15(18)19)9-13(14)17/h8-10H,4-7H2,1-3H3,(H3,18,19) |
| InChIKey | CUAGYLNGTKYPBI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|