C15H24F2N2 — CID 55148129
4-(aminomethyl)-2,6-difluoro-N-pentyl-N-propan-2-ylaniline (PubChem CID 55148129) has the molecular formula C15H24F2N2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-(aminomethyl)-2,6-difluoro-N-pentyl-N-propan-2-ylaniline.
| Compound Name | 4-(aminomethyl)-2,6-difluoro-N-pentyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 55148129 |
| Molecular Formula | C15H24F2N2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-(aminomethyl)-2,6-difluoro-N-pentyl-N-propan-2-ylaniline |
| SMILES | CCCCCN(c1c(F)cc(CN)cc1F)C(C)C |
| InChI | InChI=1S/C15H24F2N2/c1-4-5-6-7-19(11(2)3)15-13(16)8-12(10-18)9-14(15)17/h8-9,11H,4-7,10,18H2,1-3H3 |
| InChIKey | VPUHPQJWCPCNHX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|