C12H9ClN4OS — CID 81295846
4-(3-aminoprop-1-ynyl)-3-chloro-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 81295846) has the molecular formula C12H9ClN4OS and a molecular weight of 292.75 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-3-chloro-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-3-chloro-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 81295846 |
| Molecular Formula | C12H9ClN4OS |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-3-chloro-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | NCC#Cc1ccc(C(=O)Nc2nncs2)cc1Cl |
| InChI | InChI=1S/C12H9ClN4OS/c13-10-6-9(4-3-8(10)2-1-5-14)11(18)16-12-17-15-7-19-12/h3-4,6-7H,5,14H2,(H,16,17,18) |
| InChIKey | RXVVTBVFYLXAEY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|