C10H13FN2O4 — CID 81297003
ethyl 2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetate (PubChem CID 81297003) has the molecular formula C10H13FN2O4 and a molecular weight of 244.22 g/mol. Its IUPAC name is ethyl 2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetate.
| Compound Name | ethyl 2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetate |
|---|---|
| PubChem CID | 81297003 |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | ethyl 2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)n1cc(CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13FN2O4/c1-3-6-5-13(10(16)12-8(6)14)7(11)9(15)17-4-2/h5,7H,3-4H2,1-2H3,(H,12,14,16) |
| InChIKey | RUYZDVIDEFHLRK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |