C12H17FN2O4 — CID 81297442
2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2-fluoroacetic acid (PubChem CID 81297442) has the molecular formula C12H17FN2O4 and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2-fluoroacetic acid.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2-fluoroacetic acid |
|---|---|
| PubChem CID | 81297442 |
| Molecular Formula | C12H17FN2O4 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2-fluoroacetic acid |
| SMILES | O=C(O)C(F)N1C(=O)NC2(CCCCCCC2)C1=O |
| InChI | InChI=1S/C12H17FN2O4/c13-8(9(16)17)15-10(18)12(14-11(15)19)6-4-2-1-3-5-7-12/h8H,1-7H2,(H,14,19)(H,16,17) |
| InChIKey | XNARQJRMTNIGBB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|