C17H27N3O — CID 81299371
2-(4,4-diethylpiperidin-1-yl)-4-methoxybenzenecarboximidamide (PubChem CID 81299371) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(4,4-diethylpiperidin-1-yl)-4-methoxybenzenecarboximidamide.
| Compound Name | 2-(4,4-diethylpiperidin-1-yl)-4-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 81299371 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-(4,4-diethylpiperidin-1-yl)-4-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OC)cc1N1CCC(CC)(CC)CC1 |
| InChI | InChI=1S/C17H27N3O/c1-4-17(5-2)8-10-20(11-9-17)15-12-13(21-3)6-7-14(15)16(18)19/h6-7,12H,4-5,8-11H2,1-3H3,(H3,18,19) |
| InChIKey | NEILQZOUBXFYMB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|