C14H9F3N2O — CID 81306553
4-methoxy-2-(2,4,6-trifluoroanilino)benzonitrile (PubChem CID 81306553) has the molecular formula C14H9F3N2O and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-methoxy-2-(2,4,6-trifluoroanilino)benzonitrile.
| Compound Name | 4-methoxy-2-(2,4,6-trifluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 81306553 |
| Molecular Formula | C14H9F3N2O |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-methoxy-2-(2,4,6-trifluoroanilino)benzonitrile |
| SMILES | COc1ccc(C#N)c(Nc2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C14H9F3N2O/c1-20-10-3-2-8(7-18)13(6-10)19-14-11(16)4-9(15)5-12(14)17/h2-6,19H,1H3 |
| InChIKey | TXEHBMGQZKTSIL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |