C13H14F2N2O2 — CID 81309823
1-(2-amino-4,6-difluorophenyl)-4,4-dimethylpiperidine-2,6-dione (PubChem CID 81309823) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-(2-amino-4,6-difluorophenyl)-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-(2-amino-4,6-difluorophenyl)-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 81309823 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(2-amino-4,6-difluorophenyl)-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(c2c(N)cc(F)cc2F)C(=O)C1 |
| InChI | InChI=1S/C13H14F2N2O2/c1-13(2)5-10(18)17(11(19)6-13)12-8(15)3-7(14)4-9(12)16/h3-4H,5-6,16H2,1-2H3 |
| InChIKey | PELOCXORBMKMBG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|