C16H29NO2 — CID 81313655
2-[cyclopentyl-(2,4,4-trimethylcyclohexyl)amino]acetic acid (PubChem CID 81313655) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 2-[cyclopentyl-(2,4,4-trimethylcyclohexyl)amino]acetic acid.
| Compound Name | 2-[cyclopentyl-(2,4,4-trimethylcyclohexyl)amino]acetic acid |
|---|---|
| PubChem CID | 81313655 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 2-[cyclopentyl-(2,4,4-trimethylcyclohexyl)amino]acetic acid |
| SMILES | CC1CC(C)(C)CCC1N(CC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C16H29NO2/c1-12-10-16(2,3)9-8-14(12)17(11-15(18)19)13-6-4-5-7-13/h12-14H,4-11H2,1-3H3,(H,18,19) |
| InChIKey | MNICCLBKLYGMOF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |