About 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate
2-methylsulfonylethyl 5-aminopyridine-2-carboxylate (PubChem CID 81316375) has the molecular formula C9H12N2O4S
and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate |
| PubChem CID | 81316375 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate |
| SMILES | CS(=O)(=O)CCOC(=O)c1ccc(N)cn1 |
| InChI | InChI=1S/C9H12N2O4S/c1-16(13,14)5-4-15-9(12)8-3-2-7(10)6-11-8/h2-3,6H,4-5,10H2,1H3 |
| InChIKey | TUQUZIICCDOQCS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate?
The IUPAC name of 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate (CID 81316375) is 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate.
What is the SMILES notation for 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate?
The canonical SMILES for 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate is CS(=O)(=O)CCOC(=O)c1ccc(N)cn1.
What is the InChIKey of 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate?
The InChIKey is TUQUZIICCDOQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4S/c1-16(13,14)5-4-15-9(12)8-3-2-7(10)6-11-8/h2-3,6H,4-5,10H2,1H3.
What are the key properties of 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate?
2-methylsulfonylethyl 5-aminopyridine-2-carboxylate has a molecular weight of 244.27 g/mol, XLogP of -0.13, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonylethyl 5-aminopyridine-2-carboxylate is sourced from PubChem (CID 81316375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).