C11H13F3N2O3 — CID 81318177
3-(2,2,2-trifluoroethoxy)propyl 5-aminopyridine-2-carboxylate (PubChem CID 81318177) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethoxy)propyl 5-aminopyridine-2-carboxylate.
| Compound Name | 3-(2,2,2-trifluoroethoxy)propyl 5-aminopyridine-2-carboxylate |
|---|---|
| PubChem CID | 81318177 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-(2,2,2-trifluoroethoxy)propyl 5-aminopyridine-2-carboxylate |
| SMILES | Nc1ccc(C(=O)OCCCOCC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H13F3N2O3/c12-11(13,14)7-18-4-1-5-19-10(17)9-3-2-8(15)6-16-9/h2-3,6H,1,4-5,7,15H2 |
| InChIKey | ZCHAZISFERFQGK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|