About (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate
(3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate (PubChem CID 81317043) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate.
Molecular Properties
| Compound Name | (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate |
| PubChem CID | 81317043 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate |
| SMILES | COC1CCCC(OC(=O)c2ccc(N)cn2)C1 |
| InChI | InChI=1S/C13H18N2O3/c1-17-10-3-2-4-11(7-10)18-13(16)12-6-5-9(14)8-15-12/h5-6,8,10-11H,2-4,7,14H2,1H3 |
| InChIKey | ZFEAPHMDLYZDHD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate?
The IUPAC name of (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate (CID 81317043) is (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate.
What is the SMILES notation for (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate?
The canonical SMILES for (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate is COC1CCCC(OC(=O)c2ccc(N)cn2)C1.
What is the InChIKey of (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate?
The InChIKey is ZFEAPHMDLYZDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c1-17-10-3-2-4-11(7-10)18-13(16)12-6-5-9(14)8-15-12/h5-6,8,10-11H,2-4,7,14H2,1H3.
What are the key properties of (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate?
(3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate has a molecular weight of 250.30 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxycyclohexyl) 5-aminopyridine-2-carboxylate is sourced from PubChem (CID 81317043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).