C10H12F3NO3 — CID 81319773
1-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-2-one (PubChem CID 81319773) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 81319773 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-2-one |
| SMILES | COC(Cn1c(C(F)(F)F)cccc1=O)OC |
| InChI | InChI=1S/C10H12F3NO3/c1-16-9(17-2)6-14-7(10(11,12)13)4-3-5-8(14)15/h3-5,9H,6H2,1-2H3 |
| InChIKey | KNFWJKRBUOPDDC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|